Difference between revisions of "ERYTHROSE-4P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
(Created page with "Category:metabolite == Metabolite ERYTHROSE-4P == * common-name: ** d-erythrose 4-phosphate * smiles: ** [ch](c(c(cop([o-])([o-])=o)o)o)=o * inchi-key: ** nghmdnpxvrffgs-i...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ERYTHROSE-4P == |
* common-name: | * common-name: | ||
− | ** | + | ** d-erythrose 4-phosphate |
* smiles: | * smiles: | ||
− | ** c( | + | ** [ch](c(c(cop([o-])([o-])=o)o)o)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nghmdnpxvrffgs-iuyqgcfvsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 198.069 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2TRANSKETO-RXN]] | ||
+ | * [[DAHPSYN-RXN]] | ||
+ | * [[SEDOBISALDOL-RXN]] | ||
+ | * [[TRANSALDOL-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2TRANSKETO-RXN]] |
− | * [[RXN- | + | * [[DAHPSYN-RXN]] |
− | * [[RXN | + | * [[SEDOBISALDOL-RXN]] |
+ | * [[TRANSALDOL-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-erythrose 4-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nghmdnpxvrffgs-iuyqgcfvsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=198.069}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite ERYTHROSE-4P
- common-name:
- d-erythrose 4-phosphate
- smiles:
- [ch](c(c(cop([o-])([o-])=o)o)o)=o
- inchi-key:
- nghmdnpxvrffgs-iuyqgcfvsa-l
- molecular-weight:
- 198.069