Difference between revisions of "ETF-Oxidized"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite mRNA-Fragments == * common-name: ** an mrna fragment == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite CPD-14928 == * common-name: ** phytenoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14928 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytenoyl-coa |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
| + | * inchi-key: | ||
| + | ** nyzpdfuazacyot-peaqseffsa-j | ||
| + | * molecular-weight: | ||
| + | ** 1056.006 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-482]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-480]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=nyzpdfuazacyot-peaqseffsa-j}} | ||
| + | {{#set: molecular-weight=1056.006}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-14928
- common-name:
- phytenoyl-coa
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- nyzpdfuazacyot-peaqseffsa-j
- molecular-weight:
- 1056.006
