Difference between revisions of "ETF-Reduced"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...") |
(Created page with "Category:metabolite == Metabolite Enoylpimeloyl-ACP-methyl-esters == * common-name: ** an enoylpimeloyl-[acp] methyl ester == Reaction(s) known to consume the compound ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Enoylpimeloyl-ACP-methyl-esters == |
* common-name: | * common-name: | ||
| − | ** | + | ** an enoylpimeloyl-[acp] methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11482]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11481]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an enoylpimeloyl-[acp] methyl ester}} |
| − | |||
| − | |||
Revision as of 08:24, 15 March 2021
Contents
Metabolite Enoylpimeloyl-ACP-methyl-esters
- common-name:
- an enoylpimeloyl-[acp] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an enoylpimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
