Difference between revisions of "ETF-Reduced"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-MANNOSE == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4...")
(Created page with "Category:metabolite == Metabolite ETF-Reduced == * common-name: ** a reduced electron-transfer flavoprotein == Reaction(s) known to consume the compound == * 1.5.5.1-RXN...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-MANNOSE ==
+
== Metabolite ETF-Reduced ==
 
* common-name:
 
* common-name:
** gdp-α-d-mannose
+
** a reduced electron-transfer flavoprotein
* smiles:
 
** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
** mvmscbbuihutgj-gdjbgnaasa-l
 
* molecular-weight:
 
** 603.329
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.142-RXN]]
+
* [[1.5.5.1-RXN]]
* [[2.4.1.83-RXN]]
+
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
* [[GDPMANDEHYDRA-RXN]]
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
* [[MANNPGUANYLTRANGDP-RXN]]
+
* [[RXN-11734]]
* [[RXN-16602]]
+
* [[RXN-14229]]
* [[RXN-1882]]
+
* [[RXN-14262]]
* [[RXN-5462]]
+
* [[RXN-14278]]
* [[RXN-5463]]
+
* [[RXN66-550]]
* [[RXN-5464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
+
* [[1.5.5.1-RXN]]
* [[RXN-1882]]
+
* [[ACYLCOADEHYDROG-RXN]]
* [[RXN4FS-12]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11734]]
 +
* [[RXN-13449]]
 +
* [[RXN-13615]]
 +
* [[RXN-14229]]
 +
* [[RXN-14262]]
 +
* [[RXN-14278]]
 +
* [[RXN-17775]]
 +
* [[RXN-17779]]
 +
* [[RXN-17783]]
 +
* [[RXN-17784]]
 +
* [[RXN-17788]]
 +
* [[RXN-17792]]
 +
* [[RXN-17796]]
 +
* [[RXN0-2301]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-mannose}}
+
{{#set: common-name=a reduced electron-transfer flavoprotein}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}}
 
{{#set: molecular-weight=603.329}}
 

Latest revision as of 11:11, 18 March 2021