Difference between revisions of "ETF-Reduced"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-MANNOSE == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4...")
(Created page with "Category:metabolite == Metabolite Dermatan-NacGal == * common-name: ** [dermatan]-n-acetyl-d-galactosamine == Reaction(s) known to consume the compound == * RXN-11555...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-MANNOSE ==
+
== Metabolite Dermatan-NacGal ==
 
* common-name:
 
* common-name:
** gdp-α-d-mannose
+
** [dermatan]-n-acetyl-d-galactosamine
* smiles:
 
** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
** mvmscbbuihutgj-gdjbgnaasa-l
 
* molecular-weight:
 
** 603.329
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.142-RXN]]
+
* [[RXN-11555]]
* [[2.4.1.83-RXN]]
 
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 
* [[GDPMANDEHYDRA-RXN]]
 
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[RXN-16602]]
 
* [[RXN-1882]]
 
* [[RXN-5462]]
 
* [[RXN-5463]]
 
* [[RXN-5464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[RXN-1882]]
 
* [[RXN4FS-12]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-mannose}}
+
{{#set: common-name=[dermatan]-n-acetyl-d-galactosamine}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}}
 
{{#set: molecular-weight=603.329}}
 

Revision as of 15:25, 5 January 2021

Metabolite Dermatan-NacGal

  • common-name:
    • [dermatan]-n-acetyl-d-galactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "dermatan]-n-acetyl-d-galactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.