Difference between revisions of "ETHANAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...") |
(Created page with "Category:metabolite == Metabolite GLUTAMYL-GLX-TRNAS == * common-name: ** an l-glutamyl-[trnaglx] == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLUTAMYL-GLX-TRNAS == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-glutamyl-[trnaglx] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[6.1.1.24-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-glutamyl-[trnaglx]}} |
− | |||
− |
Revision as of 13:12, 14 January 2021
Contents
Metabolite GLUTAMYL-GLX-TRNAS
- common-name:
- an l-glutamyl-[trnaglx]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-glutamyl-[trnaglx" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.