|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN-CARBOXYL-RXN BIOTIN-CARBOXYL-RXN] == | + | == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** biotin carboxylase | + | ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.3.4.14 ec-6.3.4.14]
| + | ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-] |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''+''' 1 [[biotin-L-lysine-in-BCCP-dimers]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[carboxybiotin-L-lysine-in-BCCP-dimers]][c] | + | ** ovprppovaxrced-wvzvxsggsa-k |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 255.098 |
| − | * Gene: [[SJ14528]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[KDPGALDOL-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ12870]]
| + | * [[PGLUCONDEHYDRAT-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}} |
| − | * Gene: [[SJ02214]]
| + | {{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=255.098}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ12670]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ17987]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ00485]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ14529]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ06726]] | |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-5744]], glyoxylate assimilation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744] | |
| − | ** '''4''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-5743]], 3-hydroxypropanoate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743]
| |
| − | ** '''5''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789]
| |
| − | ** '''8''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13502 13502]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04385 R04385]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q06862 Q06862]
| |
| − | ** [http://www.uniprot.org/uniprot/O67483 O67483]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CHF3 Q9CHF3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58626 Q58626]
| |
| − | ** [http://www.uniprot.org/uniprot/P43873 P43873]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PN09 Q9PN09]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JW07 Q9JW07]
| |
| − | ** [http://www.uniprot.org/uniprot/P24182 P24182]
| |
| − | ** [http://www.uniprot.org/uniprot/O04983 O04983]
| |
| − | ** [http://www.uniprot.org/uniprot/O81273 O81273]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42777 Q42777]
| |
| − | ** [http://www.uniprot.org/uniprot/Q39825 Q39825]
| |
| − | ** [http://www.uniprot.org/uniprot/O23960 O23960]
| |
| − | ** [http://www.uniprot.org/uniprot/O52602 O52602]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9R9I4 Q9R9I4]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=biotin carboxylase}} | |
| − | {{#set: ec-number=ec-6.3.4.14}}
| |
| − | {{#set: nb gene associated=8}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
