Difference between revisions of "ETHYL-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] == * common-name: ** 3-mercaptopyruvate * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)ncc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-serotonin glucuronide |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** drkqfnyksnwotc-rngzqalnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 393.372 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11060]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=393.372}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-12016
- common-name:
- n-acetyl-serotonin glucuronide
- smiles:
- cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
- inchi-key:
- drkqfnyksnwotc-rngzqalnsa-m
- molecular-weight:
- 393.372
