Difference between revisions of "ETHYL-PWY"

Revision as of 20:15, 18 December 2020

[NonePHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN PHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN]
[NoneRXN-19426 RXN-19426]
[NoneRXN-19425 RXN-19425]

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
+== Pathway PWY-7618 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** n-acetyl-serotonin glucuronide
+** ricinoleate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
+* [[RXN-16151]]
-* inchi-key:
+* [[RXN-9670]]
-** drkqfnyksnwotc-rngzqalnsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NonePHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN PHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN]
-** 393.372
+* [NoneRXN-19426 RXN-19426]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-19425 RXN-19425]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[RXN-11060]]
+{{#set: common-name=ricinoleate biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=n-acetyl-serotonin glucuronide}}
+{{#set: completion rate=0.67}}
-{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
+{{#set: nb total reaction=3}}
-{{#set: molecular-weight=393.372}}