Difference between revisions of "ETHYLENE-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07783 == * transcription-direction: ** negative * right-end-position: ** 149627 * left-end-position: ** 146547 * centisome-position: ** 32.664864...") |
(Created page with "Category:metabolite == Metabolite SOLANESYL-PYROPHOSPHATE == * common-name: ** all-trans-nonaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite SOLANESYL-PYROPHOSPHATE == |
| − | * | + | * common-name: |
| − | ** | + | ** all-trans-nonaprenyl diphosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** ivlbhbftrnviap-meggaxogsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 788.015 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-2761]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-11486]] |
| − | + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=all-trans-nonaprenyl diphosphate}} | |
| − | + | {{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}} | |
| − | + | {{#set: molecular-weight=788.015}} | |
| − | * [[ | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite SOLANESYL-PYROPHOSPHATE
- common-name:
- all-trans-nonaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ivlbhbftrnviap-meggaxogsa-k
- molecular-weight:
- 788.015
