Difference between revisions of "ETOH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite ETOH == * common-name: ** ethanol * smiles: ** cco * inchi-key: ** lfqscwfljhtthz-uhfffaoysa-n * molecular-weight: ** 46.069 == Reaction(...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ETOH == |
* common-name: | * common-name: | ||
− | ** | + | ** ethanol |
* smiles: | * smiles: | ||
− | ** | + | ** cco |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lfqscwfljhtthz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 46.069 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ALCOHOL-DEHYDROG-RXN]] | ||
+ | * [[RXN-12639]] | ||
+ | * [[RXN66-1]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ALCDH_LPAREN_nadp_RPAREN_hi]] |
+ | * [[ALCDH_LPAREN_nadp_RPAREN_i]] | ||
+ | * [[ALCOHOL-DEHYDROG-RXN]] | ||
+ | * [[RXN-12484]] | ||
+ | * [[RXN-8748]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ethanol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lfqscwfljhtthz-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=46.069}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ETOH
- common-name:
- ethanol
- smiles:
- cco
- inchi-key:
- lfqscwfljhtthz-uhfffaoysa-n
- molecular-weight:
- 46.069