Difference between revisions of "ETOH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * smiles: ** cc(c)(cop(=o)([o-])[o-])c(o)c(...")
(Created page with "Category:metabolite == Metabolite ETOH == * common-name: ** ethanol * smiles: ** cco * inchi-key: ** lfqscwfljhtthz-uhfffaoysa-n * molecular-weight: ** 46.069 == Reaction(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE ==
+
== Metabolite ETOH ==
 
* common-name:
 
* common-name:
** (r)-4'-phosphopantothenoyl-l-cysteine
+
** ethanol
 
* smiles:
 
* smiles:
** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
+
** cco
 
* inchi-key:
 
* inchi-key:
** xqyalqvlcnhcft-cbapkceasa-k
+
** lfqscwfljhtthz-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 399.332
+
** 46.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[P-PANTOCYSDECARB-RXN]]
+
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[RXN-12639]]
 +
* [[RXN66-1]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[P-PANTOCYSLIG-RXN]]
+
* [[ALCDH_LPAREN_nadp_RPAREN_hi]]
 +
* [[ALCDH_LPAREN_nadp_RPAREN_i]]
 +
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[RXN-12484]]
 +
* [[RXN-8748]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}}
+
{{#set: common-name=ethanol}}
{{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}}
+
{{#set: inchi-key=inchikey=lfqscwfljhtthz-uhfffaoysa-n}}
{{#set: molecular-weight=399.332}}
+
{{#set: molecular-weight=46.069}}

Latest revision as of 11:15, 18 March 2021

Metabolite ETOH

  • common-name:
    • ethanol
  • smiles:
    • cco
  • inchi-key:
    • lfqscwfljhtthz-uhfffaoysa-n
  • molecular-weight:
    • 46.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality