Difference between revisions of "ETOH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * smiles: ** cc(c)(cop(=o)([o-])[o-])c(o)c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-4'-phosphopantothenoyl-l-cysteine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xqyalqvlcnhcft-cbapkceasa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 399.332 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[P-PANTOCYSDECARB-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[P-PANTOCYSLIG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=399.332}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE
- common-name:
- (r)-4'-phosphopantothenoyl-l-cysteine
- smiles:
- cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
- inchi-key:
- xqyalqvlcnhcft-cbapkceasa-k
- molecular-weight:
- 399.332
