Difference between revisions of "ETOH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * smiles: ** cc(c)(cop(=o)([o-])[o-])c(o)c(...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * smiles: ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) * inchi-key: ** ltqypavlayvkt...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXYISOURATE == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (s)-5-hydroxyisourate |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ltqypavlayvktk-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.111 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.5.2.17-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[URATE-OXIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(s)-5-hydroxyisourate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.111}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite 5-HYDROXYISOURATE
- common-name:
- (s)-5-hydroxyisourate
- smiles:
- c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
- inchi-key:
- ltqypavlayvktk-yfkpbyrvsa-n
- molecular-weight:
- 184.111
