Difference between revisions of "ETOH"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05431 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * NO3t ** Category: or...") |
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3710 == |
| − | + | * common-name: | |
| − | * | + | ** cytidine 2'-monophosphate |
| − | + | * smiles: | |
| − | * | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o |
| − | * | + | * inchi-key: |
| − | ** | + | ** yquakormlhpslz-xvfcmesisa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 321.183 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-12059]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=cytidine 2'-monophosphate}} | |
| − | + | {{#set: inchi-key=inchikey=yquakormlhpslz-xvfcmesisa-l}} | |
| − | {{#set: | + | {{#set: molecular-weight=321.183}} |
| − | {{#set: | ||
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPD-3710
- common-name:
- cytidine 2'-monophosphate
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
- inchi-key:
- yquakormlhpslz-xvfcmesisa-l
- molecular-weight:
- 321.183
