Difference between revisions of "ETR-Quinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15035 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine * smiles: ** cc(=o)nc2(...")
(Created page with "Category:metabolite == Metabolite NN-dimethyl-terminal-XPK == * common-name: ** an n terminal n,n-dimethyl-(a/s)pk-[protein] == Reaction(s) known to consume the compound =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15035 ==
+
== Metabolite NN-dimethyl-terminal-XPK ==
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine
+
** an n terminal n,n-dimethyl-(a/s)pk-[protein]
* smiles:
 
** cc(=o)nc2(c(oc1(oc(c(=o)[o-])=cc(o)c(os([o-])(=o)=o)1))c(o)c(co)oc(o)2)
 
* inchi-key:
 
** zeucjyoqjtzlfj-rbcdgzsosa-l
 
* molecular-weight:
 
** 457.362
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14021]]
+
* [[RXN-13224]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12890]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine}}
+
{{#set: common-name=an n terminal n,n-dimethyl-(a/s)pk-[protein]}}
{{#set: inchi-key=inchikey=zeucjyoqjtzlfj-rbcdgzsosa-l}}
 
{{#set: molecular-weight=457.362}}
 

Revision as of 18:58, 14 January 2021

Metabolite NN-dimethyl-terminal-XPK

  • common-name:
    • an n terminal n,n-dimethyl-(a/s)pk-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n terminal n,n-dimethyl-(a/s)pk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.