Difference between revisions of "Elongation-tRNAMet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
(Created page with "Category:metabolite == Metabolite Stearoyl-ACPs == * common-name: ** a stearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16024 * RXN-16076 * R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Stearoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a stearoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16024]] |
| − | * [[ | + | * [[RXN-16076]] |
| + | * [[RXN-9548]] | ||
| + | * [[RXN1G-368]] | ||
| + | * [[RXN3O-5304]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9635]] |
| − | * [[ | + | * [[RXN3O-5293]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a stearoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 11:14, 15 January 2021
Contents
Metabolite Stearoyl-ACPs
- common-name:
- a stearoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a stearoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
