Difference between revisions of "Elongation-tRNAMet"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...")
(Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL ==
+
== Metabolite Elongation-tRNAMet ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
+
** elongator trnamet
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
 
* inchi-key:
 
** zagwhopypmukok-fricuitqsa-n
 
* molecular-weight:
 
** 548.848
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-54]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=elongator trnamet}}
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
 
{{#set: molecular-weight=548.848}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Elongation-tRNAMet

  • common-name:
    • elongator trnamet

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality