Difference between revisions of "Elongation-tRNAMet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
(Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Elongation-tRNAMet == |
* common-name: | * common-name: | ||
− | ** | + | ** elongator trnamet |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[METHIONINE--TRNA-LIGASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=elongator trnamet}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Elongation-tRNAMet
- common-name:
- elongator trnamet