Difference between revisions of "Elongation-tRNAMet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL == * common-name: ** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc...") |
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYXYLULOSE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-deoxy-d-xylulose 5-phosphate |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ajpadpzsrrughi-rfzpgflssa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 212.096 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DXPREDISOM-RXN]] |
| + | * [[THIAZOLSYN2-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DXPREDISOM-RXN]] | ||
| + | * [[DXS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-deoxy-d-xylulose 5-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=212.096}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite DEOXYXYLULOSE-5P
- common-name:
- 1-deoxy-d-xylulose 5-phosphate
- smiles:
- cc(=o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- ajpadpzsrrughi-rfzpgflssa-l
- molecular-weight:
- 212.096
