Difference between revisions of "Enones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...")
(Created page with "Category:metabolite == Metabolite 4-METHYL-824-CHOLESTADIENOL == * common-name: ** 4α-methyl-zymosterol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14873 ==
+
== Metabolite 4-METHYL-824-CHOLESTADIENOL ==
 
* common-name:
 
* common-name:
** 3-amino-4-hydroxybenzoate
+
** 4α-methyl-zymosterol
 
* smiles:
 
* smiles:
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** mrbkrzapgucwos-uhfffaoysa-m
+
** foujwbxbkvvhcj-yijygbtnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 152.129
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15414]]
+
* [[RXN-13709]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4702/NAD/WATER.76.]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 +
* [[RXN11884]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN11878]]
 +
* [[RXN11884]]
 +
* [[RXN66-314]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-4-hydroxybenzoate}}
+
{{#set: common-name=4α-methyl-zymosterol}}
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=foujwbxbkvvhcj-yijygbtnsa-n}}
{{#set: molecular-weight=152.129}}
+
{{#set: molecular-weight=398.671}}

Revision as of 18:57, 14 January 2021

Metabolite 4-METHYL-824-CHOLESTADIENOL

  • common-name:
    • 4α-methyl-zymosterol
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • foujwbxbkvvhcj-yijygbtnsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality