Difference between revisions of "Enoylglutaryl-ACP-methyl-esters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite 1-Alkyl-glycerol-3-phosphate == * common-name: ** a 1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-Alkyl-glycerol-3-phosphate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1-alkyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17729]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17728]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1-alkyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Revision as of 11:16, 15 January 2021
Contents
Metabolite 1-Alkyl-glycerol-3-phosphate
- common-name:
- a 1-alkyl-sn-glycerol 3-phosphate
