Difference between revisions of "Epoxides"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00609 == * transcription-direction: ** positive * right-end-position: ** 342995 * left-end-position: ** 335452 * centisome-position: ** 59.320694...") |
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE == * common-name: ** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE == |
− | * | + | * common-name: |
− | ** | + | ** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate |
− | + | * smiles: | |
− | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c | |
− | + | * inchi-key: | |
− | * | + | ** vepicjbqcouqpi-irvxxiiisa-m |
− | + | * molecular-weight: | |
− | ** | + | ** 561.823 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[2.1.1.114-RXN]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}} | |
− | + | {{#set: inchi-key=inchikey=vepicjbqcouqpi-irvxxiiisa-m}} | |
− | * | + | {{#set: molecular-weight=561.823}} |
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE
- common-name:
- 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
- inchi-key:
- vepicjbqcouqpi-irvxxiiisa-m
- molecular-weight:
- 561.823