Difference between revisions of "Epoxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE == * common-name: ** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite Protein-S-farnesyl-L-cysteines == * common-name: ** a [protein] s-farnesyl-l-cysteine == Reaction(s) known to consume the compound == * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE ==
+
== Metabolite Protein-S-farnesyl-L-cysteines ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
+
** a [protein] s-farnesyl-l-cysteine
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** vepicjbqcouqpi-irvxxiiisa-m
 
* molecular-weight:
 
** 561.823
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.114-RXN]]
+
* [[2.5.1.58-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.5.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}}
+
{{#set: common-name=a [protein] s-farnesyl-l-cysteine}}
{{#set: inchi-key=inchikey=vepicjbqcouqpi-irvxxiiisa-m}}
 
{{#set: molecular-weight=561.823}}
 

Revision as of 14:53, 5 January 2021

Metabolite Protein-S-farnesyl-L-cysteines

  • common-name:
    • a [protein] s-farnesyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] s-farnesyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.