Difference between revisions of "Epoxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...")
(Created page with "Category:metabolite == Metabolite CARBAMOYL-P == * common-name: ** carbamoyl phosphate * smiles: ** c(=o)(n)op(=o)([o-])[o-] * inchi-key: ** ffqkyprqeygkaf-uhfffaoysa-l *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-786 ==
+
== Metabolite CARBAMOYL-P ==
 
* common-name:
 
* common-name:
** (4z)-2-oxohept-4-enedioate
+
** carbamoyl phosphate
 
* smiles:
 
* smiles:
** c(ccc=cc(c([o-])=o)=o)([o-])=o
+
** c(=o)(n)op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hyvszvzmtyihkf-iwqzzhsrsa-l
+
** ffqkyprqeygkaf-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 139.004
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[RXN-13482]]
 +
* [[RXN-14552]]
 +
* [[RXN-15284]]
 +
* [[RXN-15285]]
 +
* [[RXN-15287]]
 +
* [[RXN-9]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1K-87]]
+
* [[ASPCARBTRANS-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[RXN-13202]]
 +
* [[RXN-13482]]
 +
* [[RXN-14196]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4z)-2-oxohept-4-enedioate}}
+
{{#set: common-name=carbamoyl phosphate}}
{{#set: inchi-key=inchikey=hyvszvzmtyihkf-iwqzzhsrsa-l}}
+
{{#set: inchi-key=inchikey=ffqkyprqeygkaf-uhfffaoysa-l}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=139.004}}

Revision as of 13:07, 14 January 2021

Metabolite CARBAMOYL-P

  • common-name:
    • carbamoyl phosphate
  • smiles:
    • c(=o)(n)op(=o)([o-])[o-]
  • inchi-key:
    • ffqkyprqeygkaf-uhfffaoysa-l
  • molecular-weight:
    • 139.004

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality