Difference between revisions of "FADH2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17064 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * FE3abch ** Category: [...")
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17064 ==
+
== Metabolite FADH2 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** fadh2
== Reaction(s) associated ==
+
* smiles:
* [[FE3abch]]
+
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
** ypzrhbjkemoyqh-uybvjogssa-l
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 785.556
 +
== Reaction(s) known to consume the compound ==
 +
* [[ACOAD1f]]
 +
* [[PPCOAOm]]
 +
* [[RXN-14264]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[ACOA120OR]]
 +
* [[ACOA140OR]]
 +
* [[ACOA160OR]]
 +
* [[ACOA40OR]]
 +
* [[ACOA80OR]]
 +
* [[ACOAD1f]]
 +
* [[IVCDH]]
 +
* [[MCDH]]
 +
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 +
* [[PPCOAOm]]
 +
* [[RXN-14264]]
 +
* [[SUCDHm]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=fadh2}}
 +
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
 +
{{#set: molecular-weight=785.556}}

Latest revision as of 11:11, 18 March 2021

Metabolite FADH2

  • common-name:
    • fadh2
  • smiles:
    • cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
  • inchi-key:
    • ypzrhbjkemoyqh-uybvjogssa-l
  • molecular-weight:
    • 785.556

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality