Difference between revisions of "FAO-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYLPHENOL 2-OCTAPRENYLPHENOL] ==
+== Pathway PWY-5751 ==
+* taxonomic-range:
+** tax-33090
+** tax-131567
 * common-name:
-** 2-octaprenylphenol
+** phenylethanol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
+* [[RXN-7700]]
-* inchi-key:
+== Reaction(s) not found ==
-** vunqjppptjiren-cmaxttdksa-n
+* [NoneRXN-13536 RXN-13536]
-* molecular-weight:
+* [NoneAMINEPHEN-RXN AMINEPHEN-RXN]
-** 639.058
+* [NoneRXN-8990 RXN-8990]
-== Reaction(s) known to consume the compound ==
+* [NonePHENYLALANINE-DECARBOXYLASE-RXN PHENYLALANINE-DECARBOXYLASE-RXN]
-* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
+{{#set: taxonomic-range=tax-33090|tax-131567}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=phenylethanol biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=2-octaprenylphenol}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=639.058}}