Difference between revisions of "FAO-PWY"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRINOGEN PROTOPORPHYRINOGEN] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] ==
 * common-name:
-** protoporphyrinogen ix
+** l-canaline
 * smiles:
-** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
+** c(cc([n+])c(=o)[o-])on
 * inchi-key:
-** uhsgpdmiqqynax-uhfffaoysa-l
+** fqpgmqabjnqllf-vkhmyheasa-n
 * molecular-weight:
-** 566.699
+** 134.135
 == Reaction(s) known to consume the compound ==
-* [[PPPGO]]
+* [[RXN-9]]
-* [[PROTOPORGENOXI-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[HEMN-RXN]]
+* [[RXN-34]]
-* [[RXN0-1461]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=protoporphyrinogen ix}}
+{{#set: common-name=l-canaline}}
-{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
+{{#set: inchi-key=inchikey=fqpgmqabjnqllf-vkhmyheasa-n}}
-{{#set: molecular-weight=566.699}}
+{{#set: molecular-weight=134.135}}