Difference between revisions of "FAO-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] == * common-name: ** l-canaline * smiles: ** c(cc([n+])c(=o)[o-])on * in...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYLPHENOL 2-OCTAPRENYLPHENOL] == * common-name: ** 2-octaprenylphenol * smiles: ** cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CANALINE L-CANALINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYLPHENOL 2-OCTAPRENYLPHENOL] ==
 
* common-name:
 
* common-name:
** l-canaline
+
** 2-octaprenylphenol
 
* smiles:
 
* smiles:
** c(cc([n+])c(=o)[o-])on
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** fqpgmqabjnqllf-vkhmyheasa-n
+
** vunqjppptjiren-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 134.135
+
** 639.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-34]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-canaline}}
+
{{#set: common-name=2-octaprenylphenol}}
{{#set: inchi-key=inchikey=fqpgmqabjnqllf-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
{{#set: molecular-weight=134.135}}
+
{{#set: molecular-weight=639.058}}

Revision as of 09:22, 27 August 2019

Metabolite 2-OCTAPRENYLPHENOL

  • common-name:
    • 2-octaprenylphenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • vunqjppptjiren-cmaxttdksa-n
  • molecular-weight:
    • 639.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality