Difference between revisions of "FECOSTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12018 == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) * inchi-key: ** jtejppkmybdemy-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite CPD-19683 == * common-name: ** an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-ace...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-19683 == |
* common-name: | * common-name: | ||
− | ** | + | ** an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15277]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r}} |
− | |||
− |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-19683
- common-name:
- an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-(1,3)-[n-acetyl-β-d-glucosyl-(1,6)]-β-d-galactosyl-(1,4)-n-acetyl-β-d-glucosaminyl-r" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.