Difference between revisions of "FERRICYTOCHROME-B5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFD2i MTHFD2i] == * direction: ** left-to-right * common-name: ** methylenetetrahydrofolate dehyd...")
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFD2i MTHFD2i] ==
+
== Metabolite CPD-9957 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** methylenetetrahydrofolate dehydrogenase  nad
+
** ubiquinol-9
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[5-10-METHENYL-THF]][c] '''+''' 1.0 [[NADH]][c] '''=>''' 1.0 [[METHYLENE-THF]][c] '''+''' 1.0 [[NAD]][c] '''+''' 1.0 [[PROTON]][c]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ02922]]
+
** npcoqxavbjjzbq-wjnluyjisa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 797.255
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[2.1.1.64-RXN]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=ubiquinol-9}}
−
{{#set: common-name=methylenetetrahydrofolate dehydrogenase  nad }}
+
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=797.255}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-9957

  • common-name:
    • ubiquinol-9
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
  • inchi-key:
    • npcoqxavbjjzbq-wjnluyjisa-n
  • molecular-weight:
    • 797.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=FERRICYTOCHROME-B5&oldid=48485"