Difference between revisions of "FERRICYTOCHROME-B5"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2E-9Z-octadeca-2-9-dienoyl-ACPs == * common-name: ** a (2e,9z)-octadeca-2,9-dienoyl-[acp] == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-7061 == * common-name: ** pheophorbide a * smiles: ** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=2...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7061 == |
* common-name: | * common-name: | ||
− | ** a ( | + | ** pheophorbide a |
+ | * smiles: | ||
+ | ** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6)))))) | ||
+ | * inchi-key: | ||
+ | ** uxwyeazhzlzdgm-zvevzsnksa-m | ||
+ | * molecular-weight: | ||
+ | ** 590.677 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17252]] |
+ | * [[RXN-7740]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=a | + | {{#set: common-name=pheophorbide a}} |
+ | {{#set: inchi-key=inchikey=uxwyeazhzlzdgm-zvevzsnksa-m}} | ||
+ | {{#set: molecular-weight=590.677}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-7061
- common-name:
- pheophorbide a
- smiles:
- c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
- inchi-key:
- uxwyeazhzlzdgm-zvevzsnksa-m
- molecular-weight:
- 590.677