Difference between revisions of "FERRICYTOCHROME-B5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7061 == * common-name: ** pheophorbide a * smiles: ** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=2...")
(Created page with "Category:metabolite == Metabolite CPD-16491 == * common-name: ** 2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine * smiles: ** cn([ch]=o)c1(c(o)=nc(n)=nc(n)=1) * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7061 ==
+
== Metabolite CPD-16491 ==
 
* common-name:
 
* common-name:
** pheophorbide a
+
** 2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine
 
* smiles:
 
* smiles:
** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
+
** cn([ch]=o)c1(c(o)=nc(n)=nc(n)=1)
 
* inchi-key:
 
* inchi-key:
** uxwyeazhzlzdgm-zvevzsnksa-m
+
** cgwdnafnqobsck-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 590.677
+
** 183.169
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17252]]
 
* [[RXN-7740]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.2.23-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pheophorbide a}}
+
{{#set: common-name=2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine}}
{{#set: inchi-key=inchikey=uxwyeazhzlzdgm-zvevzsnksa-m}}
+
{{#set: inchi-key=inchikey=cgwdnafnqobsck-uhfffaoysa-n}}
{{#set: molecular-weight=590.677}}
+
{{#set: molecular-weight=183.169}}

Revision as of 13:13, 14 January 2021

Metabolite CPD-16491

  • common-name:
    • 2,6-diamino-4-hydroxy-5-(n-methyl)formamidopyrimidine
  • smiles:
    • cn([ch]=o)c1(c(o)=nc(n)=nc(n)=1)
  • inchi-key:
    • cgwdnafnqobsck-uhfffaoysa-n
  • molecular-weight:
    • 183.169

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality