Difference between revisions of "FERROCYTOCHROME-B5"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3483 == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** akoaevosdhivfx-uhfffa...") |
(Created page with "Category:metabolite == Metabolite FERROCYTOCHROME-B5 == * common-name: ** a ferrocytochrome b5 == Reaction(s) known to consume the compound == <div class="toccolours mw-co...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FERROCYTOCHROME-B5 == |
* common-name: | * common-name: | ||
− | ** | + | ** a ferrocytochrome b5 |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> | ||
+ | * [[1.14.19.1-RXN]] | ||
+ | * [[1.14.19.3-RXN]] | ||
+ | * [[1.14.21.6-RXN]] | ||
+ | * [[1.14.99.33-RXN]] | ||
+ | * [[CY_focytb5_LPAREN_c_RPAREN_]] | ||
+ | * [[PHOSPHATIDYLCHOLINE-DESATURASE-RXN]] | ||
+ | * [[RXN-10664]] | ||
+ | * [[RXN-11680]] | ||
+ | * [[RXN-11681]] | ||
+ | * [[RXN-11682]] | ||
+ | * [[RXN-11887]] | ||
+ | * [[RXN-12755]] | ||
+ | * [[RXN-13426]] | ||
+ | * [[RXN-13709]] | ||
+ | * [[RXN-13712]] | ||
+ | * [[RXN-13883]] | ||
+ | * [[RXN-13892]] | ||
+ | * [[RXN-14491]] | ||
+ | * [[RXN-16040]] | ||
+ | * [[RXN-16046]] | ||
+ | * [[RXN-16065]] | ||
+ | * [[RXN-16099]] | ||
+ | * [[RXN-16101]] | ||
+ | * [[RXN-16132]] | ||
+ | * [[RXN-16149]] | ||
+ | * [[RXN-16378]] | ||
+ | * [[RXN-17105]] | ||
+ | * [[RXN-17112]] | ||
+ | * [[RXN-21829]] | ||
+ | * [[RXN-4209]] | ||
+ | * [[RXN-7796]] | ||
+ | * [[RXN-8320]] | ||
+ | * [[RXN-8321]] | ||
+ | * [[RXN-8322]] | ||
+ | * [[RXN-8323]] | ||
+ | * [[RXN-8324]] | ||
+ | * [[RXN-8325]] | ||
+ | * [[RXN-8326]] | ||
+ | * [[RXN-8327]] | ||
+ | * [[RXN-8328]] | ||
+ | * [[RXN-8329]] | ||
+ | * [[RXN-8330]] | ||
+ | * [[RXN-8331]] | ||
+ | * [[RXN-8347]] | ||
+ | * [[RXN-8360]] | ||
+ | * [[RXN-8361]] | ||
+ | * [[RXN-9601]] | ||
+ | * [[RXN-9616]] | ||
+ | * [[RXN-9669]] | ||
+ | * [[RXN3O-218]] | ||
+ | </div> | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CYTOCHROME-B5-REDUCTASE-RXN]] |
+ | * [[CY_focytb5_LPAREN_c_RPAREN_]] | ||
+ | * [[RXN-16378]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a ferrocytochrome b5}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite FERROCYTOCHROME-B5
- common-name:
- a ferrocytochrome b5
Reaction(s) known to consume the compound
- 1.14.19.1-RXN
- 1.14.19.3-RXN
- 1.14.21.6-RXN
- 1.14.99.33-RXN
- CY_focytb5_LPAREN_c_RPAREN_
- PHOSPHATIDYLCHOLINE-DESATURASE-RXN
- RXN-10664
- RXN-11680
- RXN-11681
- RXN-11682
- RXN-11887
- RXN-12755
- RXN-13426
- RXN-13709
- RXN-13712
- RXN-13883
- RXN-13892
- RXN-14491
- RXN-16040
- RXN-16046
- RXN-16065
- RXN-16099
- RXN-16101
- RXN-16132
- RXN-16149
- RXN-16378
- RXN-17105
- RXN-17112
- RXN-21829
- RXN-4209
- RXN-7796
- RXN-8320
- RXN-8321
- RXN-8322
- RXN-8323
- RXN-8324
- RXN-8325
- RXN-8326
- RXN-8327
- RXN-8328
- RXN-8329
- RXN-8330
- RXN-8331
- RXN-8347
- RXN-8360
- RXN-8361
- RXN-9601
- RXN-9616
- RXN-9669
- RXN3O-218