Difference between revisions of "FERROCYTOCHROME-B5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12129 == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite FERROCYTOCHROME-B5 == * common-name: ** a ferrocytochrome b5 == Reaction(s) known to consume the compound == <div class="toccolours mw-co...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12129 ==
+
== Metabolite FERROCYTOCHROME-B5 ==
 
* common-name:
 
* common-name:
−
** menaquinol-12
+
** a ferrocytochrome b5
−
* smiles:
 
−
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
 
−
* inchi-key:
 
−
** fwfjgqgpmzxtlm-wppieqshsa-n
 
−
* molecular-weight:
 
−
** 991.617
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.14.19.1-RXN]]
 +
* [[1.14.19.3-RXN]]
 +
* [[1.14.21.6-RXN]]
 +
* [[1.14.99.33-RXN]]
 +
* [[CY_focytb5_LPAREN_c_RPAREN_]]
 +
* [[PHOSPHATIDYLCHOLINE-DESATURASE-RXN]]
 +
* [[RXN-10664]]
 +
* [[RXN-11680]]
 +
* [[RXN-11681]]
 +
* [[RXN-11682]]
 +
* [[RXN-11887]]
 +
* [[RXN-12755]]
 +
* [[RXN-13426]]
 +
* [[RXN-13709]]
 +
* [[RXN-13712]]
 +
* [[RXN-13883]]
 +
* [[RXN-13892]]
 +
* [[RXN-14491]]
 +
* [[RXN-16040]]
 +
* [[RXN-16046]]
 +
* [[RXN-16065]]
 +
* [[RXN-16099]]
 +
* [[RXN-16101]]
 +
* [[RXN-16132]]
 +
* [[RXN-16149]]
 +
* [[RXN-16378]]
 +
* [[RXN-17105]]
 +
* [[RXN-17112]]
 +
* [[RXN-21829]]
 +
* [[RXN-4209]]
 +
* [[RXN-7796]]
 +
* [[RXN-8320]]
 +
* [[RXN-8321]]
 +
* [[RXN-8322]]
 +
* [[RXN-8323]]
 +
* [[RXN-8324]]
 +
* [[RXN-8325]]
 +
* [[RXN-8326]]
 +
* [[RXN-8327]]
 +
* [[RXN-8328]]
 +
* [[RXN-8329]]
 +
* [[RXN-8330]]
 +
* [[RXN-8331]]
 +
* [[RXN-8347]]
 +
* [[RXN-8360]]
 +
* [[RXN-8361]]
 +
* [[RXN-9601]]
 +
* [[RXN-9616]]
 +
* [[RXN-9669]]
 +
* [[RXN3O-218]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-9363]]
+
* [[CYTOCHROME-B5-REDUCTASE-RXN]]
 +
* [[CY_focytb5_LPAREN_c_RPAREN_]]
 +
* [[RXN-16378]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=menaquinol-12}}
+
{{#set: common-name=a ferrocytochrome b5}}
−
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
 
−
{{#set: molecular-weight=991.617}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite FERROCYTOCHROME-B5

  • common-name:
    • a ferrocytochrome b5

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=FERROCYTOCHROME-B5&oldid=138160"