Difference between revisions of "FERROCYTOCHROME-B5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05034 == * transcription-direction: ** negative * right-end-position: ** 94672 * left-end-position: ** 70502 * centisome-position: ** 72.06804...")
(Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05034 ==
+
== Metabolite CPD-15370 ==
* transcription-direction:
+
* common-name:
** negative
+
** trans-lesqueroloyl-coa
* right-end-position:
+
* smiles:
** 94672
+
** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 70502
+
** fgrjeqcmqcquqf-fscwmumrsa-j
* centisome-position:
+
* molecular-weight:
** 72.06804   
+
** 1069.99
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-14494]]
* [[3.2.1.113-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=trans-lesqueroloyl-coa}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
* [[3.2.1.24-RXN]]
+
{{#set: molecular-weight=1069.99}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=94672}}
 
{{#set: left-end-position=70502}}
 
{{#set: centisome-position=72.06804    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-15370

  • common-name:
    • trans-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • fgrjeqcmqcquqf-fscwmumrsa-j
  • molecular-weight:
    • 1069.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality