Difference between revisions of "FERROCYTOCHROME-B5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3483 == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** akoaevosdhivfx-uhfffa...")
(Created page with "Category:metabolite == Metabolite CPD-12129 == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3483 ==
+
== Metabolite CPD-12129 ==
 
* common-name:
 
* common-name:
** hydroxybupropion
+
** menaquinol-12
 
* smiles:
 
* smiles:
** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1)
+
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
 
* inchi-key:
 
* inchi-key:
** akoaevosdhivfx-uhfffaoysa-o
+
** fwfjgqgpmzxtlm-wppieqshsa-n
 
* molecular-weight:
 
* molecular-weight:
** 256.752
+
** 991.617
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-181]]
+
* [[RXN-9363]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hydroxybupropion}}
+
{{#set: common-name=menaquinol-12}}
{{#set: inchi-key=inchikey=akoaevosdhivfx-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
{{#set: molecular-weight=256.752}}
+
{{#set: molecular-weight=991.617}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-12129

  • common-name:
    • menaquinol-12
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
  • inchi-key:
    • fwfjgqgpmzxtlm-wppieqshsa-n
  • molecular-weight:
    • 991.617

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality