Difference between revisions of "FERULIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-12699 == * common-name: ** (2r)-2-hydroxy-2-methylbutanenitrile * smiles: ** ccc(c)(o)c#n * inchi-key: ** vmehotodtpxckt-yfkpbyrvsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12699 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r)-2-hydroxy-2-methylbutanenitrile |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(c)(o)c#n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vmehotodtpxckt-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 99.132 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9674]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r)-2-hydroxy-2-methylbutanenitrile}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vmehotodtpxckt-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=99.132}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite CPD-12699
- common-name:
- (2r)-2-hydroxy-2-methylbutanenitrile
- smiles:
- ccc(c)(o)c#n
- inchi-key:
- vmehotodtpxckt-yfkpbyrvsa-n
- molecular-weight:
- 99.132
