Difference between revisions of "FERULIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12699 == * common-name: ** (2r)-2-hydroxy-2-methylbutanenitrile * smiles: ** ccc(c)(o)c#n * inchi-key: ** vmehotodtpxckt-yfkpbyrvsa-n...") |
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13404 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-aspartate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xaewtdmgfghwfk-imjsidkusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6975]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-aspartate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.174}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-13404
- common-name:
- l-alanyl-l-aspartate
- smiles:
- cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
- inchi-key:
- xaewtdmgfghwfk-imjsidkusa-m
- molecular-weight:
- 203.174
