Difference between revisions of "FERULIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...") |
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FERULIC-ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** ferulate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ksebmyqbyztdhs-hwkanzrosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 193.179 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6.2.1.34-RXN]] |
| + | * [[RXN-1121]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.1.73-RXN]] | ||
| + | * [[RXN-1104]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ferulate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=193.179}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite FERULIC-ACID
- common-name:
- ferulate
- smiles:
- coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
- inchi-key:
- ksebmyqbyztdhs-hwkanzrosa-m
- molecular-weight:
- 193.179
