Difference between revisions of "FERULIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14998 == * transcription-direction: ** negative * right-end-position: ** 158637 * left-end-position: ** 157229 * centisome-position: ** 22.201496...") |
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite FERULIC-ACID == |
| − | * | + | * common-name: |
| − | ** | + | ** ferulate |
| − | * | + | * smiles: |
| − | ** | + | ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** ksebmyqbyztdhs-hwkanzrosa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 193.179 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[6.2.1.34-RXN]] |
| − | == Reaction(s) | + | * [[RXN-1121]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[3.1.1.73-RXN]] |
| − | + | * [[RXN-1104]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=ferulate}} |
| − | + | {{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}} | |
| − | {{#set: | + | {{#set: molecular-weight=193.179}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite FERULIC-ACID
- common-name:
- ferulate
- smiles:
- coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
- inchi-key:
- ksebmyqbyztdhs-hwkanzrosa-m
- molecular-weight:
- 193.179
