Difference between revisions of "FERULIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Uridine32-in-tRNA == * common-name: ** a uridine32 in trna == Reaction(s) known to consume the compound == * RXN-11842 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FERULIC-ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** ferulate |
| + | * smiles: | ||
| + | ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) | ||
| + | * inchi-key: | ||
| + | ** ksebmyqbyztdhs-hwkanzrosa-m | ||
| + | * molecular-weight: | ||
| + | ** 193.179 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[6.2.1.34-RXN]] |
| + | * [[RXN-1121]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.1.73-RXN]] | ||
| + | * [[RXN-1104]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ferulate}} |
| + | {{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}} | ||
| + | {{#set: molecular-weight=193.179}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite FERULIC-ACID
- common-name:
- ferulate
- smiles:
- coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
- inchi-key:
- ksebmyqbyztdhs-hwkanzrosa-m
- molecular-weight:
- 193.179
