Difference between revisions of "FERULIC-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Uridine32-in-tRNA == * common-name: ** a uridine32 in trna == Reaction(s) known to consume the compound == * RXN-11842 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Uridine32-in-tRNA ==
+
== Metabolite FERULIC-ACID ==
 
* common-name:
 
* common-name:
** a uridine32 in trna
+
** ferulate
 +
* smiles:
 +
** coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
 +
* inchi-key:
 +
** ksebmyqbyztdhs-hwkanzrosa-m
 +
* molecular-weight:
 +
** 193.179
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11842]]
+
* [[6.2.1.34-RXN]]
 +
* [[RXN-1121]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.1.1.73-RXN]]
 +
* [[RXN-1104]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uridine32 in trna}}
+
{{#set: common-name=ferulate}}
 +
{{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}}
 +
{{#set: molecular-weight=193.179}}

Revision as of 18:52, 14 January 2021

Metabolite FERULIC-ACID

  • common-name:
    • ferulate
  • smiles:
    • coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
  • inchi-key:
    • ksebmyqbyztdhs-hwkanzrosa-m
  • molecular-weight:
    • 193.179

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality