Difference between revisions of "FERULOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite FERULOYL-COA == * common-name: ** feruloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1162 ==
+
== Metabolite FERULOYL-COA ==
 
* common-name:
 
* common-name:
** (2e,5z)-tetradecenoyl-coa
+
** feruloyl-coa
 
* smiles:
 
* smiles:
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jvefyxpcqbmmaa-zmlwrgbosa-j
+
** gbxzvjqqdajgso-nbxnmegssa-j
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 939.674
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5393]]
+
* [[RXN-1106]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14576]]
+
* [[6.2.1.34-RXN]]
* [[RXN-17783]]
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
+
{{#set: common-name=feruloyl-coa}}
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
+
{{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=939.674}}

Latest revision as of 11:13, 18 March 2021

Metabolite FERULOYL-COA

  • common-name:
    • feruloyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • gbxzvjqqdajgso-nbxnmegssa-j
  • molecular-weight:
    • 939.674

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality