Difference between revisions of "FERULOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21688 == * transcription-direction: ** positive * right-end-position: ** 673314 * left-end-position: ** 651059 * centisome-position: ** 57.554363...") |
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-1162 == |
| − | * | + | * common-name: |
| − | ** | + | ** (2e,5z)-tetradecenoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** jvefyxpcqbmmaa-zmlwrgbosa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 969.83 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-5393]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN- | + | * [[RXN-14576]] |
| − | * | + | * [[RXN-17783]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(2e,5z)-tetradecenoyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}} | |
| − | + | {{#set: molecular-weight=969.83}} | |
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD0-1162
- common-name:
- (2e,5z)-tetradecenoyl-coa
- smiles:
- ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- jvefyxpcqbmmaa-zmlwrgbosa-j
- molecular-weight:
- 969.83
