Difference between revisions of "FERULOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite biotin-L-lysine-in-BCCP-dimers == * common-name: ** a [biotin carboxyl-carrier-protein dimer]-n6-biotinyl-l-lysine == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite CPD-7137 == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7137 == |
* common-name: | * common-name: | ||
− | ** | + | ** pelargonidin-3,5-di-o-β-d-glucoside |
+ | * smiles: | ||
+ | ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o) | ||
+ | * inchi-key: | ||
+ | ** slckjkwfulxzbd-zotffytfsa-n | ||
+ | * molecular-weight: | ||
+ | ** 594.525 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7828]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}} |
+ | {{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}} | ||
+ | {{#set: molecular-weight=594.525}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-7137
- common-name:
- pelargonidin-3,5-di-o-β-d-glucoside
- smiles:
- c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
- inchi-key:
- slckjkwfulxzbd-zotffytfsa-n
- molecular-weight:
- 594.525