Difference between revisions of "FESULFOX-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] == * common-name: ** n-acetyl-...")
(Created page with "Category:pathway == Pathway PWY-6958 == * taxonomic-range: ** tax-3041 ** tax-3208 * common-name: ** icosapentaenoate biosynthesis i (lower eukaryotes) == Reaction(s) foun...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-GLUCOSAMINYLAMINE N-ACETYL-BETA-GLUCOSAMINYLAMINE] ==
+
== Pathway PWY-6958 ==
 +
* taxonomic-range:
 +
** tax-3041
 +
** tax-3208
 
* common-name:
 
* common-name:
** n-acetyl-β-glucosaminylamine
+
** icosapentaenoate biosynthesis i (lower eukaryotes)
* smiles:
+
== Reaction(s) found ==
** cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
+
* [[RXN-16020]]
* inchi-key:
+
* [[RXN-16021]]
** mcgxocxffnkasf-fmdgeedcsa-n
+
* [[RXN-16041]]
* molecular-weight:
+
* [[RXN-16042]]
** 220.225
+
* [[RXN-8347]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-8350 RXN-8350]
* [[3.5.1.26-RXN]]
+
* [NoneRXN-16019 RXN-16019]
* [[3.5.1.52-RXN]]
+
* [NoneRXN-16022 RXN-16022]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-3041|tax-3208}}
{{#set: common-name=n-acetyl-β-glucosaminylamine}}
+
{{#set: common-name=icosapentaenoate biosynthesis i (lower eukaryotes)}}
{{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}}
+
{{#set: nb reaction found=5}}
{{#set: molecular-weight=220.225}}
+
{{#set: completion rate=0.62}}
 +
{{#set: nb total reaction=8}}

Revision as of 20:18, 18 December 2020

Pathway PWY-6958

  • taxonomic-range:
    • tax-3041
    • tax-3208
  • common-name:
    • icosapentaenoate biosynthesis i (lower eukaryotes)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8350 RXN-8350]
  • [NoneRXN-16019 RXN-16019]
  • [NoneRXN-16022 RXN-16022]