Difference between revisions of "FLAVANONES"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...") |
(Created page with "Category:metabolite == Metabolite FLAVANONES == * common-name: ** a flavanone == Reaction(s) known to consume the compound == * CHALCONE-ISOMERASE-RXN == Reaction(s) k...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FLAVANONES == |
* common-name: | * common-name: | ||
− | ** | + | ** a flavanone |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CHALCONE-ISOMERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[CHALCONE-ISOMERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a flavanone}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FLAVANONES
- common-name:
- a flavanone