Difference between revisions of "FMN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-HYDROXYMETHYLGLUTATHIONE == * common-name: ** s-(hydroxymethyl)glutathione * smiles: ** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o...")
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-HYDROXYMETHYLGLUTATHIONE ==
+
== Metabolite FMN ==
 
* common-name:
 
* common-name:
** s-(hydroxymethyl)glutathione
+
** fmn
 
* smiles:
 
* smiles:
** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
+
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
 
* inchi-key:
 
* inchi-key:
** piuslwsyoyfrfr-bqbzgakwsa-m
+
** ankzybdxhmzbdk-scrdcrapsa-k
 
* molecular-weight:
 
* molecular-weight:
** 336.339
+
** 453.324
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2962]]
+
* [[FAD-PYROPHOSPHATASE-RXN]]
* [[RXN0-276]]
+
* [[FADSYN-RXN]]
 +
* [[RXN-9510]]
 +
* [[RXN0-5187]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-276]]
+
* [[ARPT]]
 +
* [[FAD-PYROPHOSPHATASE-RXN]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[RXN-9510]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(hydroxymethyl)glutathione}}
+
{{#set: common-name=fmn}}
{{#set: inchi-key=inchikey=piuslwsyoyfrfr-bqbzgakwsa-m}}
+
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
{{#set: molecular-weight=336.339}}
+
{{#set: molecular-weight=453.324}}

Latest revision as of 11:17, 18 March 2021

Metabolite FMN

  • common-name:
    • fmn
  • smiles:
    • cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
  • inchi-key:
    • ankzybdxhmzbdk-scrdcrapsa-k
  • molecular-weight:
    • 453.324

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality