Difference between revisions of "FMN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UMPU UMPU] == * direction: ** left-to-right * common-name: ** utp:utp-monosaccharide-1-phosphate ur...")
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UMPU UMPU] ==
+
== Metabolite FMN ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** utp:utp-monosaccharide-1-phosphate uridylyltransferase
+
** fmn
== Reaction formula ==
+
* smiles:
* 1.0 [[CPD-1825]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UDP]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[UDP-L-ARABINOSE]][c]
+
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ06954]]
+
** ankzybdxhmzbdk-scrdcrapsa-k
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 453.324
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[FAD-PYROPHOSPHATASE-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[FADSYN-RXN]]
== External links  ==
+
* [[RXN-9510]]
{{#set: direction=left-to-right}}
+
* [[RXN0-5187]]
{{#set: common-name=utp:utp-monosaccharide-1-phosphate uridylyltransferase}}
+
== Reaction(s) known to produce the compound ==
{{#set: nb gene associated=1}}
+
* [[ARPT]]
{{#set: nb pathway associated=0}}
+
* [[FAD-PYROPHOSPHATASE-RXN]]
{{#set: reconstruction category=orthology}}
+
* [[RIBOFLAVINKIN-RXN]]
{{#set: reconstruction tool=pantograph}}
+
* [[RXN-9510]]
{{#set: reconstruction comment=n.a}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
{{#set: common-name=fmn}}
 +
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
 +
{{#set: molecular-weight=453.324}}

Latest revision as of 11:17, 18 March 2021

Metabolite FMN

  • common-name:
    • fmn
  • smiles:
    • cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
  • inchi-key:
    • ankzybdxhmzbdk-scrdcrapsa-k
  • molecular-weight:
    • 453.324

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality